C26H25BrN4O2 — CID 42712571
1-benzyl-3-(2-bromophenyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea (PubChem CID 42712571) has the molecular formula C26H25BrN4O2 and a molecular weight of 505.42 g/mol. Its IUPAC name is 1-benzyl-3-(2-bromophenyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea.
| Compound Name | 1-benzyl-3-(2-bromophenyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 42712571 |
| Molecular Formula | C26H25BrN4O2 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-benzyl-3-(2-bromophenyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccccc1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C26H25BrN4O2/c1-3-23(24-28-21-15-9-7-13-19(21)25(32)30(24)2)31(17-18-11-5-4-6-12-18)26(33)29-22-16-10-8-14-20(22)27/h4-16,23H,3,17H2,1-2H3,(H,29,33) |
| InChIKey | QFMCLDSTLZUPLM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |