C24H23BrN4O3 — CID 42712578
3-(2-bromophenyl)-1-(furan-2-ylmethyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea (PubChem CID 42712578) has the molecular formula C24H23BrN4O3 and a molecular weight of 495.38 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-(furan-2-ylmethyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea.
| Compound Name | 3-(2-bromophenyl)-1-(furan-2-ylmethyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 42712578 |
| Molecular Formula | C24H23BrN4O3 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 3-(2-bromophenyl)-1-(furan-2-ylmethyl)-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccco1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C24H23BrN4O3/c1-3-21(22-26-19-12-6-4-10-17(19)23(30)28(22)2)29(15-16-9-8-14-32-16)24(31)27-20-13-7-5-11-18(20)25/h4-14,21H,3,15H2,1-2H3,(H,27,31) |
| InChIKey | JODPFPMBBYVHTI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |