C26H27ClN4O3 — CID 4667171
3-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-(furan-2-ylmethyl)urea (PubChem CID 4667171) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 3-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-(furan-2-ylmethyl)urea.
| Compound Name | 3-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 4667171 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-(furan-2-ylmethyl)urea |
| SMILES | CCC(c1nc2cc(Cl)ccc2c(=O)n1CC)N(Cc1ccco1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-3-23(24-29-22-15-19(27)12-13-21(22)25(32)30(24)4-2)31(17-20-11-8-14-34-20)26(33)28-16-18-9-6-5-7-10-18/h5-15,23H,3-4,16-17H2,1-2H3,(H,28,33) |
| InChIKey | GBMOHJQMLVFFHI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |