C27H27ClN4O2 — CID 3607239
3-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-ethylurea (PubChem CID 3607239) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 3-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-ethylurea.
| Compound Name | 3-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-ethylurea |
|---|---|
| PubChem CID | 3607239 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-ethylurea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)N(CC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H27ClN4O2/c1-3-24(31(4-2)27(34)29-18-19-10-6-5-7-11-19)25-30-23-13-9-8-12-22(23)26(33)32(25)21-16-14-20(28)15-17-21/h5-17,24H,3-4,18H2,1-2H3,(H,29,34) |
| InChIKey | REXJNERXRWHQFC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |