C32H29ClN4O3 — CID 4292539
1-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-(3-methoxyphenyl)urea (PubChem CID 4292539) has the molecular formula C32H29ClN4O3 and a molecular weight of 553.06 g/mol. Its IUPAC name is 1-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4292539 |
| Molecular Formula | C32H29ClN4O3 |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 1-benzyl-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]propyl]-3-(3-methoxyphenyl)urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)N(Cc1ccccc1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C32H29ClN4O3/c1-3-29(30-35-28-15-8-7-14-27(28)31(38)37(30)25-18-16-23(33)17-19-25)36(21-22-10-5-4-6-11-22)32(39)34-24-12-9-13-26(20-24)40-2/h4-20,29H,3,21H2,1-2H3,(H,34,39) |
| InChIKey | RKCVSHRHZZBZST-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |