C27H27ClN4O3 — CID 42722815
3-(4-chlorophenyl)-1-ethyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea (PubChem CID 42722815) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea.
| Compound Name | 3-(4-chlorophenyl)-1-ethyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 42722815 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccccc1OC)N(CC)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27ClN4O3/c1-4-22(31(5-2)27(34)29-19-16-14-18(28)15-17-19)25-30-21-11-7-6-10-20(21)26(33)32(25)23-12-8-9-13-24(23)35-3/h6-17,22H,4-5H2,1-3H3,(H,29,34) |
| InChIKey | OMFMJKIGKLXUNS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |