C30H34N4O4 — CID 4573937
1-butyl-3-(2-methoxyphenyl)-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea (PubChem CID 4573937) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-butyl-3-(2-methoxyphenyl)-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea.
| Compound Name | 1-butyl-3-(2-methoxyphenyl)-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 4573937 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 1-butyl-3-(2-methoxyphenyl)-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
| SMILES | CCCCN(C(=O)Nc1ccccc1OC)C(CC)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C30H34N4O4/c1-5-7-20-33(30(36)32-23-16-10-12-18-26(23)37-3)24(6-2)28-31-22-15-9-8-14-21(22)29(35)34(28)25-17-11-13-19-27(25)38-4/h8-19,24H,5-7,20H2,1-4H3,(H,32,36) |
| InChIKey | IOTOUSTYWCYCQY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |