C31H36N4O3 — CID 42723161
1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-methylphenyl)-1-pentylurea (PubChem CID 42723161) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-methylphenyl)-1-pentylurea.
| Compound Name | 1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-methylphenyl)-1-pentylurea |
|---|---|
| PubChem CID | 42723161 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-methylphenyl)-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1ccc(C)cc1)C(CC)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C31H36N4O3/c1-5-7-12-21-34(31(37)32-23-19-17-22(3)18-20-23)26(6-2)29-33-25-14-9-8-13-24(25)30(36)35(29)27-15-10-11-16-28(27)38-4/h8-11,13-20,26H,5-7,12,21H2,1-4H3,(H,32,37) |
| InChIKey | SKFRCDUQYUGSLC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|