C30H33N5O5 — CID 4316745
1-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-nitrophenyl)-1-pentylurea (PubChem CID 4316745) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-nitrophenyl)-1-pentylurea.
| Compound Name | 1-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-nitrophenyl)-1-pentylurea |
|---|---|
| PubChem CID | 4316745 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-3-(4-nitrophenyl)-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H33N5O5/c1-4-6-9-20-33(30(37)31-21-12-14-23(15-13-21)35(38)39)27(5-2)28-32-26-11-8-7-10-25(26)29(36)34(28)22-16-18-24(40-3)19-17-22/h7-8,10-19,27H,4-6,9,20H2,1-3H3,(H,31,37) |
| InChIKey | APJMUKXHOQYZIS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|