C31H35N5O5 — CID 42722054
1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexyl-3-(4-nitrophenyl)urea (PubChem CID 42722054) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is 1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexyl-3-(4-nitrophenyl)urea.
| Compound Name | 1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexyl-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42722054 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexyl-3-(4-nitrophenyl)urea |
| SMILES | CCCCCCN(C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C31H35N5O5/c1-4-6-7-10-21-34(31(38)32-23-13-15-25(16-14-23)36(39)40)22(3)29-33-28-12-9-8-11-27(28)30(37)35(29)24-17-19-26(20-18-24)41-5-2/h8-9,11-20,22H,4-7,10,21H2,1-3H3,(H,32,38) |
| InChIKey | FEXTXVONCYIVIZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|