C31H29ClF6N4O2 — CID 42715592
3-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea (PubChem CID 42715592) has the molecular formula C31H29ClF6N4O2 and a molecular weight of 639.04 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea |
|---|---|
| PubChem CID | 42715592 |
| Molecular Formula | C31H29ClF6N4O2 |
| Molecular Weight | 639.04 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea |
| SMILES | CCCCCCN(C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClF6N4O2/c1-3-4-5-8-15-41(29(44)39-23-17-20(30(33,34)35)16-21(18-23)31(36,37)38)19(2)27-40-26-10-7-6-9-25(26)28(43)42(27)24-13-11-22(32)12-14-24/h6-7,9-14,16-19H,3-5,8,15H2,1-2H3,(H,39,44) |
| InChIKey | QCVIMTUFWXACBF-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.04 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|