C31H34F2N4O2 — CID 42721888
3-(2,4-difluorophenyl)-1-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea (PubChem CID 42721888) has the molecular formula C31H34F2N4O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea |
|---|---|
| PubChem CID | 42721888 |
| Molecular Formula | C31H34F2N4O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-hexylurea |
| SMILES | CCCCCCN(C(=O)Nc1ccc(F)cc1F)C(C)c1nc2ccccc2c(=O)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C31H34F2N4O2/c1-4-6-7-10-19-36(31(39)35-28-18-15-23(32)20-26(28)33)21(3)29-34-27-12-9-8-11-25(27)30(38)37(29)24-16-13-22(5-2)14-17-24/h8-9,11-18,20-21H,4-7,10,19H2,1-3H3,(H,35,39) |
| InChIKey | RYJBKDHVBZVQLF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|