C25H32N6O4 — CID 42715511
1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)-1-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]urea (PubChem CID 42715511) has the molecular formula C25H32N6O4 and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)-1-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)-1-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 42715511 |
| Molecular Formula | C25H32N6O4 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-(4-nitrophenyl)-1-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]urea |
| SMILES | CCCn1c(C(CC)N(CCN(C)C)C(=O)Nc2ccc([N+](=O)[O-])cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H32N6O4/c1-5-15-30-23(27-21-10-8-7-9-20(21)24(30)32)22(6-2)29(17-16-28(3)4)25(33)26-18-11-13-19(14-12-18)31(34)35/h7-14,22H,5-6,15-17H2,1-4H3,(H,26,33) |
| InChIKey | RHXWLSUYUGUAPY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|