C30H40N4O4 — CID 42657801
methyl 4-[2-[1-[hexyl-[(4-methylphenyl)carbamoyl]amino]propyl]-4-oxoquinazolin-3-yl]butanoate (PubChem CID 42657801) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is methyl 4-[2-[1-[hexyl-[(4-methylphenyl)carbamoyl]amino]propyl]-4-oxoquinazolin-3-yl]butanoate.
| Compound Name | methyl 4-[2-[1-[hexyl-[(4-methylphenyl)carbamoyl]amino]propyl]-4-oxoquinazolin-3-yl]butanoate |
|---|---|
| PubChem CID | 42657801 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | methyl 4-[2-[1-[hexyl-[(4-methylphenyl)carbamoyl]amino]propyl]-4-oxoquinazolin-3-yl]butanoate |
| SMILES | CCCCCCN(C(=O)Nc1ccc(C)cc1)C(CC)c1nc2ccccc2c(=O)n1CCCC(=O)OC |
| InChI | InChI=1S/C30H40N4O4/c1-5-7-8-11-20-33(30(37)31-23-18-16-22(3)17-19-23)26(6-2)28-32-25-14-10-9-13-24(25)29(36)34(28)21-12-15-27(35)38-4/h9-10,13-14,16-19,26H,5-8,11-12,15,20-21H2,1-4H3,(H,31,37) |
| InChIKey | BCPCFCOOCXUNPM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|