C29H35N5O4 — CID 45488523
methyl 3-[2-[1-[(3-cyanophenyl)carbamoyl-hexylamino]propyl]-4-oxoquinazolin-3-yl]propanoate (PubChem CID 45488523) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is methyl 3-[2-[1-[(3-cyanophenyl)carbamoyl-hexylamino]propyl]-4-oxoquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[2-[1-[(3-cyanophenyl)carbamoyl-hexylamino]propyl]-4-oxoquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 45488523 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | methyl 3-[2-[1-[(3-cyanophenyl)carbamoyl-hexylamino]propyl]-4-oxoquinazolin-3-yl]propanoate |
| SMILES | CCCCCCN(C(=O)Nc1cccc(C#N)c1)C(CC)c1nc2ccccc2c(=O)n1CCC(=O)OC |
| InChI | InChI=1S/C29H35N5O4/c1-4-6-7-10-17-33(29(37)31-22-13-11-12-21(19-22)20-30)25(5-2)27-32-24-15-9-8-14-23(24)28(36)34(27)18-16-26(35)38-3/h8-9,11-15,19,25H,4-7,10,16-18H2,1-3H3,(H,31,37) |
| InChIKey | CROXTUUNTXKQDU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|