C24H28N4O4 — CID 42713290
N-butyl-4-nitro-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]benzamide (PubChem CID 42713290) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-butyl-4-nitro-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]benzamide.
| Compound Name | N-butyl-4-nitro-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 42713290 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-butyl-4-nitro-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]benzamide |
| SMILES | CCCCN(C(=O)c1ccc([N+](=O)[O-])cc1)C(C)c1nc2ccccc2c(=O)n1CCC |
| InChI | InChI=1S/C24H28N4O4/c1-4-6-16-26(23(29)18-11-13-19(14-12-18)28(31)32)17(3)22-25-21-10-8-7-9-20(21)24(30)27(22)15-5-2/h7-14,17H,4-6,15-16H2,1-3H3 |
| InChIKey | ZKUXNUABPIFAOC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|