C25H30N4O4 — CID 42716796
N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-4-methyl-3-nitro-N-pentylbenzamide (PubChem CID 42716796) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-4-methyl-3-nitro-N-pentylbenzamide.
| Compound Name | N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-4-methyl-3-nitro-N-pentylbenzamide |
|---|---|
| PubChem CID | 42716796 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-4-methyl-3-nitro-N-pentylbenzamide |
| SMILES | CCCCCN(C(=O)c1ccc(C)c([N+](=O)[O-])c1)C(C)c1nc2ccccc2c(=O)n1CC |
| InChI | InChI=1S/C25H30N4O4/c1-5-7-10-15-28(24(30)19-14-13-17(3)22(16-19)29(32)33)18(4)23-26-21-12-9-8-11-20(21)25(31)27(23)6-2/h8-9,11-14,16,18H,5-7,10,15H2,1-4H3 |
| InChIKey | OZWIPYVXZZVULI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|