C29H31N5O5 — CID 42722847
N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-nitrobenzamide (PubChem CID 42722847) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-nitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42722847 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-nitrobenzamide |
| SMILES | CCOc1ccccc1-n1c(C(C)N(CCN(C)C)C(=O)c2ccc([N+](=O)[O-])cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H31N5O5/c1-5-39-26-13-9-8-12-25(26)33-27(30-24-11-7-6-10-23(24)29(33)36)20(2)32(19-18-31(3)4)28(35)21-14-16-22(17-15-21)34(37)38/h6-17,20H,5,18-19H2,1-4H3 |
| InChIKey | RMJRBEQXFQCVQJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|