C37H39N3O3 — CID 42722539
N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentyl-2,2-diphenylacetamide (PubChem CID 42722539) has the molecular formula C37H39N3O3 and a molecular weight of 573.74 g/mol. Its IUPAC name is N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentyl-2,2-diphenylacetamide.
| Compound Name | N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 42722539 |
| Molecular Formula | C37H39N3O3 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentyl-2,2-diphenylacetamide |
| SMILES | CCCCCN(C(=O)C(c1ccccc1)c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1OCC |
| InChI | InChI=1S/C37H39N3O3/c1-4-6-17-26-39(37(42)34(28-18-9-7-10-19-28)29-20-11-8-12-21-29)27(3)35-38-31-23-14-13-22-30(31)36(41)40(35)32-24-15-16-25-33(32)43-5-2/h7-16,18-25,27,34H,4-6,17,26H2,1-3H3 |
| InChIKey | PCFGHYCVGHKUEQ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|