C31H33N5O5 — CID 42722854
(E)-N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 42722854) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is (E)-N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42722854 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (E)-N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1-n1c(C(C)N(CCN(C)C)C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C31H33N5O5/c1-5-41-28-13-9-8-12-27(28)35-30(32-26-11-7-6-10-25(26)31(35)38)22(2)34(21-20-33(3)4)29(37)19-16-23-14-17-24(18-15-23)36(39)40/h6-19,22H,5,20-21H2,1-4H3/b19-16+ |
| InChIKey | WRRLWSYCMKUYBB-KNTRCKAVSA-N |
| XLogP | 4.86 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|