C37H48N4O3 — CID 42723180
3-[2,6-di(propan-2-yl)phenyl]-1-hexyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea (PubChem CID 42723180) has the molecular formula C37H48N4O3 and a molecular weight of 596.82 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-hexyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-hexyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 42723180 |
| Molecular Formula | C37H48N4O3 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-hexyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
| SMILES | CCCCCCN(C(=O)Nc1c(C(C)C)cccc1C(C)C)C(CC)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C37H48N4O3/c1-8-10-11-16-24-40(37(43)39-34-27(25(3)4)19-17-20-28(34)26(5)6)31(9-2)35-38-30-21-13-12-18-29(30)36(42)41(35)32-22-14-15-23-33(32)44-7/h12-15,17-23,25-26,31H,8-11,16,24H2,1-7H3,(H,39,43) |
| InChIKey | QIJXKUYJMXJZKB-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|