C31H30N4O2 — CID 4025783
1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]-3-naphthalen-1-yl-1-(2-phenylethyl)urea (PubChem CID 4025783) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]-3-naphthalen-1-yl-1-(2-phenylethyl)urea.
| Compound Name | 1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]-3-naphthalen-1-yl-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 4025783 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]-3-naphthalen-1-yl-1-(2-phenylethyl)urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N(CCc1ccccc1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C31H30N4O2/c1-3-28(29-32-27-18-10-9-17-25(27)30(36)34(29)2)35(21-20-22-12-5-4-6-13-22)31(37)33-26-19-11-15-23-14-7-8-16-24(23)26/h4-19,28H,3,20-21H2,1-2H3,(H,33,37) |
| InChIKey | MCIRVXMZHUTBHI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |