C19H25N3O4 — CID 42711700
ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate (PubChem CID 42711700) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42711700 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(C)C(C)c1nc2ccccc2c(=O)n1CC |
| InChI | InChI=1S/C19H25N3O4/c1-5-22-18(20-15-10-8-7-9-14(15)19(22)25)13(3)21(4)16(23)11-12-17(24)26-6-2/h7-10,13H,5-6,11-12H2,1-4H3 |
| InChIKey | OVSOQCIDRKZKFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |