C20H21ClN4O3 — CID 42715226
1-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-(4-methoxyphenyl)-1-methylurea (PubChem CID 42715226) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 1-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-(4-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-(4-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 42715226 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-(4-methoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)C(C)c2nc3ccc(Cl)cc3c(=O)n2C)cc1 |
| InChI | InChI=1S/C20H21ClN4O3/c1-12(24(2)20(27)22-14-6-8-15(28-4)9-7-14)18-23-17-10-5-13(21)11-16(17)19(26)25(18)3/h5-12H,1-4H3,(H,22,27) |
| InChIKey | GBMFZPOOCZRRMG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |