C56H57BCl4N11O8 — CID 162250347
CID 162250347 (PubChem CID 162250347) has the molecular formula C56H57BCl4N11O8 and a molecular weight of 1164.76 g/mol.
| Compound Name | CID 162250347 |
|---|---|
| PubChem CID | 162250347 |
| Molecular Formula | C56H57BCl4N11O8 |
| Molecular Weight | 1164.76 g/mol |
| Exact Mass | 1162.32 |
| IUPAC Name | — |
| SMILES | COc1ccc(N(C(=O)Nc2ccc(Cl)cc2)C(C)c2nc3ccc(Cl)cc3c(=O)n2CC/N=C(\C)N)c(OC)c1.COc1ccc(N(C(=O)Nc2ccc(Cl)cc2)C(C)c2nc3ccc(Cl)cc3c(=O)n2CCN)c(OC)c1.[B] |
| InChI | InChI=1S/C29H30Cl2N6O4.C27H27Cl2N5O4.B/c1-17(27-35-24-11-7-20(31)15-23(24)28(38)36(27)14-13-33-18(2)32)37(25-12-10-22(40-3)16-26(25)41-4)29(39)34-21-8-5-19(30)6-9-21;1-16(25-32-22-10-6-18(29)14-21(22)26(35)33(25)13-12-30)34(23-11-9-20(37-2)15-24(23)38-3)27(36)31-19-7-4-17(28)5-8-19;/h5-12,15-17H,13-14H2,1-4H3,(H2,32,33)(H,34,39);4-11,14-16H,12-13,30H2,1-3H3,(H,31,36); |
| InChIKey | XJITYOXAKKNQTN-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 235.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.76 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|