C25H25N3O — CID 1051972
3-benzyl-2-[(1S)-1-(benzylamino)propyl]quinazolin-4-one (PubChem CID 1051972) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-benzyl-2-[(1S)-1-(benzylamino)propyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[(1S)-1-(benzylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 1051972 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-benzyl-2-[(1S)-1-(benzylamino)propyl]quinazolin-4-one |
| SMILES | CC[C@H](NCc1ccccc1)c1nc2ccccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H25N3O/c1-2-22(26-17-19-11-5-3-6-12-19)24-27-23-16-10-9-15-21(23)25(29)28(24)18-20-13-7-4-8-14-20/h3-16,22,26H,2,17-18H2,1H3/t22-/m0/s1 |
| InChIKey | DFSJKIQFLYLLRX-QFIPXVFZSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |