About 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide
3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide (PubChem CID 159340253) has the molecular formula C30H38N2O4
and a molecular weight of 490.64 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide |
| PubChem CID | 159340253 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide |
| SMILES | CCCCCC(=O)CCCCc1nc2cc(C)ccc2c(=O)n1-c1ccc(C(C)(C)C)cc1.O=C=O |
| InChI | InChI=1S/C29H38N2O2.CO2/c1-6-7-8-11-24(32)12-9-10-13-27-30-26-20-21(2)14-19-25(26)28(33)31(27)23-17-15-22(16-18-23)29(3,4)5;2-1-3/h14-20H,6-13H2,1-5H3; |
| InChIKey | LGAYBVGFGMQTQJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide?
The IUPAC name of 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide (CID 159340253) is 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide.
What is the SMILES notation for 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide?
The canonical SMILES for 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide is CCCCCC(=O)CCCCc1nc2cc(C)ccc2c(=O)n1-c1ccc(C(C)(C)C)cc1.O=C=O.
What is the InChIKey of 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide?
The InChIKey is LGAYBVGFGMQTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H38N2O2.CO2/c1-6-7-8-11-24(32)12-9-10-13-27-30-26-20-21(2)14-19-25(26)28(33)31(27)23-17-15-22(16-18-23)29(3,4)5;2-1-3/h14-20H,6-13H2,1-5H3;.
What are the key properties of 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide?
3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide has a molecular weight of 490.64 g/mol, XLogP of 6.27, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)-7-methyl-2-(5-oxodecyl)quinazolin-4-one;carbon dioxide is sourced from PubChem (CID 159340253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).