C27H29F3N2O4 — CID 157394225
carbon dioxide;7-methyl-2-(5-oxodecyl)-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 157394225) has the molecular formula C27H29F3N2O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is carbon dioxide;7-methyl-2-(5-oxodecyl)-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | carbon dioxide;7-methyl-2-(5-oxodecyl)-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 157394225 |
| Molecular Formula | C27H29F3N2O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | carbon dioxide;7-methyl-2-(5-oxodecyl)-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCCCCC(=O)CCCCc1nc2cc(C)ccc2c(=O)n1-c1cccc(C(F)(F)F)c1.O=C=O |
| InChI | InChI=1S/C26H29F3N2O2.CO2/c1-3-4-5-11-21(32)12-6-7-13-24-30-23-16-18(2)14-15-22(23)25(33)31(24)20-10-8-9-19(17-20)26(27,28)29;2-1-3/h8-10,14-17H,3-7,11-13H2,1-2H3; |
| InChIKey | BMJLIPZPKPXZBH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|