C24H26F3N3O2S — CID 42735235
2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanyl-N-pentylbutanamide (PubChem CID 42735235) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanyl-N-pentylbutanamide.
| Compound Name | 2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanyl-N-pentylbutanamide |
|---|---|
| PubChem CID | 42735235 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[4-oxo-3-[3-(trifluoromethyl)phenyl]quinazolin-2-yl]sulfanyl-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)C(CC)Sc1nc2ccccc2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N3O2S/c1-3-5-8-14-28-21(31)20(4-2)33-23-29-19-13-7-6-12-18(19)22(32)30(23)17-11-9-10-16(15-17)24(25,26)27/h6-7,9-13,15,20H,3-5,8,14H2,1-2H3,(H,28,31) |
| InChIKey | AXSHNOOFNYXJTL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|