C24H19Cl2N3O2S — CID 23801475
N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanamide (PubChem CID 23801475) has the molecular formula C24H19Cl2N3O2S and a molecular weight of 484.41 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 23801475 |
| Molecular Formula | C24H19Cl2N3O2S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1nc2ccccc2c(=O)n1-c1ccccc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl2N3O2S/c1-2-21(22(30)27-15-12-13-18(25)19(26)14-15)32-24-28-20-11-7-6-10-17(20)23(31)29(24)16-8-4-3-5-9-16/h3-14,21H,2H2,1H3,(H,27,30) |
| InChIKey | UZVZUDDPWQUPGS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |