C27H25N3O4S — CID 23772266
ethyl 4-[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanoylamino]benzoate (PubChem CID 23772266) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is ethyl 4-[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanoylamino]benzoate.
| Compound Name | ethyl 4-[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 23772266 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | ethyl 4-[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)Sc2nc3ccccc3c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-3-23(24(31)28-19-16-14-18(15-17-19)26(33)34-4-2)35-27-29-22-13-9-8-12-21(22)25(32)30(27)20-10-6-5-7-11-20/h5-17,23H,3-4H2,1-2H3,(H,28,31) |
| InChIKey | WTQATRRXYLXNQD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |