C20H21N3O3S — CID 1260086
ethyl 4-[[(2S)-2-(1H-benzimidazol-2-ylsulfanyl)butanoyl]amino]benzoate (PubChem CID 1260086) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-(1H-benzimidazol-2-ylsulfanyl)butanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2S)-2-(1H-benzimidazol-2-ylsulfanyl)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 1260086 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | ethyl 4-[[(2S)-2-(1H-benzimidazol-2-ylsulfanyl)butanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](CC)Sc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-3-17(27-20-22-15-7-5-6-8-16(15)23-20)18(24)21-14-11-9-13(10-12-14)19(25)26-4-2/h5-12,17H,3-4H2,1-2H3,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | HTFUNWVMDGELAI-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |