C18H18ClN3OS — CID 23942332
2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-chloro-4-methylphenyl)butanamide (PubChem CID 23942332) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-chloro-4-methylphenyl)butanamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-chloro-4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 23942332 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-chloro-4-methylphenyl)butanamide |
| SMILES | CCC(Sc1nc2ccccc2[nH]1)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClN3OS/c1-3-16(17(23)20-12-9-8-11(2)13(19)10-12)24-18-21-14-6-4-5-7-15(14)22-18/h4-10,16H,3H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | UFYQUDRGJRSJNB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |