C25H23N3O4S — CID 92644423
ethyl 4-[[(2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetyl]amino]benzoate (PubChem CID 92644423) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 92644423 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | ethyl 4-[[(2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](Sc2nc3ccc(OC)cc3[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-3-32-24(30)17-9-11-18(12-10-17)26-23(29)22(16-7-5-4-6-8-16)33-25-27-20-14-13-19(31-2)15-21(20)28-25/h4-15,22H,3H2,1-2H3,(H,26,29)(H,27,28)/t22-/m1/s1 |
| InChIKey | OSOQNKRIEMDCLK-JOCHJYFZSA-N |
| XLogP | 5.22 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |