C22H20N2O3S — CID 123132769
ethyl 4-[(2-phenyl-2-pyridin-2-ylsulfanylacetyl)amino]benzoate (PubChem CID 123132769) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is ethyl 4-[(2-phenyl-2-pyridin-2-ylsulfanylacetyl)amino]benzoate.
| Compound Name | ethyl 4-[(2-phenyl-2-pyridin-2-ylsulfanylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 123132769 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 4-[(2-phenyl-2-pyridin-2-ylsulfanylacetyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Sc2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-2-27-22(26)17-11-13-18(14-12-17)24-21(25)20(16-8-4-3-5-9-16)28-19-10-6-7-15-23-19/h3-15,20H,2H2,1H3,(H,24,25) |
| InChIKey | BZTJWQWGWGOGRY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |