C22H21N3O3S — CID 46304876
ethyl 4-[2-(6-phenylpyrimidin-4-yl)sulfanylpropanoylamino]benzoate (PubChem CID 46304876) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is ethyl 4-[2-(6-phenylpyrimidin-4-yl)sulfanylpropanoylamino]benzoate.
| Compound Name | ethyl 4-[2-(6-phenylpyrimidin-4-yl)sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 46304876 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl 4-[2-(6-phenylpyrimidin-4-yl)sulfanylpropanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Sc2cc(-c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-3-28-22(27)17-9-11-18(12-10-17)25-21(26)15(2)29-20-13-19(23-14-24-20)16-7-5-4-6-8-16/h4-15H,3H2,1-2H3,(H,25,26) |
| InChIKey | NUXWLUGXAWYXNY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |