C27H25N3O3S2 — CID 46305026
ethyl 4-phenyl-2-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]thiophene-3-carboxylate (PubChem CID 46305026) has the molecular formula C27H25N3O3S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46305026 |
| Molecular Formula | C27H25N3O3S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | ethyl 4-phenyl-2-[2-(6-phenylpyrimidin-4-yl)sulfanylbutanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(CC)Sc1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C27H25N3O3S2/c1-3-22(35-23-15-21(28-17-29-23)19-13-9-6-10-14-19)25(31)30-26-24(27(32)33-4-2)20(16-34-26)18-11-7-5-8-12-18/h5-17,22H,3-4H2,1-2H3,(H,30,31) |
| InChIKey | YVVNPRWAWJGMIE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|