C28H26N4O3S2 — CID 46303989
ethyl 2-[2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 46303989) has the molecular formula C28H26N4O3S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is ethyl 2-[2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 46303989 |
| Molecular Formula | C28H26N4O3S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | ethyl 2-[2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(CC)Sc1nnc2cc(C)c3ccccc3n12 |
| InChI | InChI=1S/C28H26N4O3S2/c1-4-22(37-28-31-30-23-15-17(3)19-13-9-10-14-21(19)32(23)28)25(33)29-26-24(27(34)35-5-2)20(16-36-26)18-11-7-6-8-12-18/h6-16,22H,4-5H2,1-3H3,(H,29,33) |
| InChIKey | XZPQSQVLSVUUIZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|