C25H25N5O3S2 — CID 2393164
ethyl 2-[[(2R)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropanoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 2393164) has the molecular formula C25H25N5O3S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropanoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2R)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropanoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2393164 |
| Molecular Formula | C25H25N5O3S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | ethyl 2-[[(2R)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylpropanoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)[C@@H](C)Sc1nnnn1-c1ccc(C)cc1C |
| InChI | InChI=1S/C25H25N5O3S2/c1-5-33-24(32)21-19(18-9-7-6-8-10-18)14-34-23(21)26-22(31)17(4)35-25-27-28-29-30(25)20-12-11-15(2)13-16(20)3/h6-14,17H,5H2,1-4H3,(H,26,31)/t17-/m1/s1 |
| InChIKey | JQMGTVJHYUTUBB-QGZVFWFLSA-N |
| XLogP | 5.30 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|