C31H32N2O6S2 — CID 18897910
6-[[3-[1-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18897910) has the molecular formula C31H32N2O6S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 6-[[3-[1-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[1-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18897910 |
| Molecular Formula | C31H32N2O6S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 6-[[3-[1-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)C2CC=CCC2C(=O)O)c1 |
| InChI | InChI=1S/C31H32N2O6S2/c1-3-25(28(35)33-29-26(31(38)39-4-2)24(18-40-29)19-11-6-5-7-12-19)41-21-14-10-13-20(17-21)32-27(34)22-15-8-9-16-23(22)30(36)37/h5-14,17-18,22-23,25H,3-4,15-16H2,1-2H3,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | FXRQYCVAYAUBTA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|