C31H29ClN2O4S2 — CID 18910508
ethyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 18910508) has the molecular formula C31H29ClN2O4S2 and a molecular weight of 593.17 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910508 |
| Molecular Formula | C31H29ClN2O4S2 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | ethyl 2-[2-[3-[(3-chlorobenzoyl)amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C31H29ClN2O4S2/c1-4-26(40-24-11-7-10-23(17-24)33-28(35)21-8-6-9-22(32)16-21)29(36)34-30-27(31(37)38-5-2)25(18-39-30)20-14-12-19(3)13-15-20/h6-18,26H,4-5H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | YUWDHNBSLFKPEF-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|