C32H32N2O6S2 — CID 18911894
ethyl 2-[2-[3-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 18911894) has the molecular formula C32H32N2O6S2 and a molecular weight of 604.75 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18911894 |
| Molecular Formula | C32H32N2O6S2 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | ethyl 2-[2-[3-[(2,6-dimethoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C32H32N2O6S2/c1-6-40-32(37)27-24(21-15-13-19(2)14-16-21)18-41-31(27)34-29(35)20(3)42-23-10-7-9-22(17-23)33-30(36)28-25(38-4)11-8-12-26(28)39-5/h7-18,20H,6H2,1-5H3,(H,33,36)(H,34,35) |
| InChIKey | RKIHRGCARXDATJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|