C36H32N2O5S2 — CID 18910937
ethyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate (PubChem CID 18910937) has the molecular formula C36H32N2O5S2 and a molecular weight of 636.80 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910937 |
| Molecular Formula | C36H32N2O5S2 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(=O)COc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C36H32N2O5S2/c1-3-42-36(41)32-30(25-19-17-24(2)18-20-25)23-44-35(32)38-34(40)33(26-11-6-4-7-12-26)45-29-16-10-13-27(21-29)37-31(39)22-43-28-14-8-5-9-15-28/h4-21,23,33H,3,22H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | IYBMFCVFBMJRHO-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|