C35H30N2O5S2 — CID 18910936
methyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate (PubChem CID 18910936) has the molecular formula C35H30N2O5S2 and a molecular weight of 622.77 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910936 |
| Molecular Formula | C35H30N2O5S2 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2-[[2-[3-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(=O)COc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C35H30N2O5S2/c1-23-16-18-24(19-17-23)29-22-43-34(31(29)35(40)41-2)37-33(39)32(25-10-5-3-6-11-25)44-28-15-9-12-26(20-28)36-30(38)21-42-27-13-7-4-8-14-27/h3-20,22,32H,21H2,1-2H3,(H,36,38)(H,37,39) |
| InChIKey | CSKOSRXEMAPXHI-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|