C29H26N2O4S2 — CID 18908824
methyl 2-[[2-(3-acetamidophenyl)sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 18908824) has the molecular formula C29H26N2O4S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is methyl 2-[[2-(3-acetamidophenyl)sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(3-acetamidophenyl)sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18908824 |
| Molecular Formula | C29H26N2O4S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | methyl 2-[[2-(3-acetamidophenyl)sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(C)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O4S2/c1-18-12-14-20(15-13-18)24-17-36-28(25(24)29(34)35-3)31-27(33)26(21-8-5-4-6-9-21)37-23-11-7-10-22(16-23)30-19(2)32/h4-17,26H,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | AJDKSBGOQOQNEG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|