C46H41N3O5S2 — CID 19052788
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19052788) has the molecular formula C46H41N3O5S2 and a molecular weight of 779.98 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052788 |
| Molecular Formula | C46H41N3O5S2 |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.25 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(=O)/C(=C\c2ccc(C(C)C)cc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C46H41N3O5S2/c1-29(2)32-24-20-31(21-25-32)26-39(48-42(50)35-14-9-6-10-15-35)43(51)47-36-16-11-17-37(27-36)56-41(34-12-7-5-8-13-34)44(52)49-45-40(46(53)54-4)38(28-55-45)33-22-18-30(3)19-23-33/h5-29,41H,1-4H3,(H,47,51)(H,48,50)(H,49,52)/b39-26+ |
| InChIKey | XSYXLNXEAXOWOH-JBFMKSPFSA-N |
| XLogP | 10.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|