C36H31N3O6S2 — CID 19052557
methyl 2-[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19052557) has the molecular formula C36H31N3O6S2 and a molecular weight of 665.79 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052557 |
| Molecular Formula | C36H31N3O6S2 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C36H31N3O6S2/c1-22-14-16-24(17-15-22)29-21-46-35(31(29)36(43)44-3)39-32(40)23(2)47-28-13-7-11-26(19-28)37-34(42)30(20-27-12-8-18-45-27)38-33(41)25-9-5-4-6-10-25/h4-21,23H,1-3H3,(H,37,42)(H,38,41)(H,39,40)/b30-20- |
| InChIKey | JFUPILRWWMMMSD-COEJQBHMSA-N |
| XLogP | 7.63 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|