C35H29N3O6S2 — CID 19052590
methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19052590) has the molecular formula C35H29N3O6S2 and a molecular weight of 651.77 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052590 |
| Molecular Formula | C35H29N3O6S2 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.15 |
| IUPAC Name | methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CSc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C35H29N3O6S2/c1-22-13-15-23(16-14-22)28-20-46-34(31(28)35(42)43-2)38-30(39)21-45-27-12-6-10-25(18-27)36-33(41)29(19-26-11-7-17-44-26)37-32(40)24-8-4-3-5-9-24/h3-20H,21H2,1-2H3,(H,36,41)(H,37,40)(H,38,39)/b29-19- |
| InChIKey | KNCQXWRKAFPMJW-CEUNXORHSA-N |
| XLogP | 7.24 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|