C43H34FN3O5S2 — CID 19052392
methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19052392) has the molecular formula C43H34FN3O5S2 and a molecular weight of 755.89 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052392 |
| Molecular Formula | C43H34FN3O5S2 |
| Molecular Weight | 755.89 g/mol |
| Exact Mass | 755.19 |
| IUPAC Name | methyl 2-[[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C43H34FN3O5S2/c1-27-20-22-28(23-21-27)34-26-53-42(37(34)43(51)52-2)47-41(50)38(29-12-5-3-6-13-29)54-33-18-11-17-32(25-33)45-40(49)36(24-31-16-9-10-19-35(31)44)46-39(48)30-14-7-4-8-15-30/h3-26,38H,1-2H3,(H,45,49)(H,46,48)(H,47,50)/b36-24- |
| InChIKey | WBTIITKKGRTMQY-IBTHDSTKSA-N |
| XLogP | 9.53 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.89 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|