C26H21NO3S2 — CID 5206052
methyl 4-phenyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 5206052) has the molecular formula C26H21NO3S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl 4-phenyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-phenyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5206052 |
| Molecular Formula | C26H21NO3S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | methyl 4-phenyl-2-[(2-phenyl-2-phenylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21NO3S2/c1-30-26(29)22-21(18-11-5-2-6-12-18)17-31-25(22)27-24(28)23(19-13-7-3-8-14-19)32-20-15-9-4-10-16-20/h2-17,23H,1H3,(H,27,28) |
| InChIKey | ICXYDTRJSCRXGY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|